C20H31ClN4O — CID 176748271
5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide (PubChem CID 176748271) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176748271 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCC(N3CCC(C(C)(C)C)C3)CC2)c(Cl)n1 |
| InChI | InChI=1S/C20H31ClN4O/c1-20(2,3)14-7-10-25(13-14)15-8-11-24(12-9-15)17-6-5-16(19(26)22-4)23-18(17)21/h5-6,14-15H,7-13H2,1-4H3,(H,22,26) |
| InChIKey | NKRSYMKPZXKDLR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|