C20H31FN4O — CID 176748212
5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-3-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 176748212) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-3-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-3-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176748212 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 5-[4-(3-tert-butylpyrrolidin-1-yl)piperidin-1-yl]-3-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ncc(N2CCC(N3CCC(C(C)(C)C)C3)CC2)cc1F |
| InChI | InChI=1S/C20H31FN4O/c1-20(2,3)14-5-8-25(13-14)15-6-9-24(10-7-15)16-11-17(21)18(23-12-16)19(26)22-4/h11-12,14-15H,5-10,13H2,1-4H3,(H,22,26) |
| InChIKey | UHBXVGFYVOVZMK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |