C18H28BFN4O — CID 176560735
3-fluoro-N-methyl-5-[4-(1-propylborolan-3-yl)piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 176560735) has the molecular formula C18H28BFN4O and a molecular weight of 346.26 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-[4-(1-propylborolan-3-yl)piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | 3-fluoro-N-methyl-5-[4-(1-propylborolan-3-yl)piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176560735 |
| Molecular Formula | C18H28BFN4O |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 3-fluoro-N-methyl-5-[4-(1-propylborolan-3-yl)piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CCCB1CCC(N2CCN(c3cnc(C(=O)NC)c(F)c3)CC2)C1 |
| InChI | InChI=1S/C18H28BFN4O/c1-3-5-19-6-4-14(12-19)23-7-9-24(10-8-23)15-11-16(20)17(22-13-15)18(25)21-2/h11,13-14H,3-10,12H2,1-2H3,(H,21,25) |
| InChIKey | NUDQMCAVLYNUBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|