C12H17FN4O — CID 167179068
3-fluoro-N-methyl-5-[(2R)-2-methylpiperazin-1-yl]pyridine-2-carboxamide (PubChem CID 167179068) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-[(2R)-2-methylpiperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | 3-fluoro-N-methyl-5-[(2R)-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167179068 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-fluoro-N-methyl-5-[(2R)-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ncc(N2CCNC[C@H]2C)cc1F |
| InChI | InChI=1S/C12H17FN4O/c1-8-6-15-3-4-17(8)9-5-10(13)11(16-7-9)12(18)14-2/h5,7-8,15H,3-4,6H2,1-2H3,(H,14,18)/t8-/m1/s1 |
| InChIKey | LBKDXWIXZLDWJE-MRVPVSSYSA-N |
| XLogP | 0.38 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |