C11H13F3N2 — CID 64930528
2-methyl-1-(2,3,5-trifluorophenyl)piperazine (PubChem CID 64930528) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-methyl-1-(2,3,5-trifluorophenyl)piperazine.
| Compound Name | 2-methyl-1-(2,3,5-trifluorophenyl)piperazine |
|---|---|
| PubChem CID | 64930528 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-methyl-1-(2,3,5-trifluorophenyl)piperazine |
| SMILES | CC1CNCCN1c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H13F3N2/c1-7-6-15-2-3-16(7)10-5-8(12)4-9(13)11(10)14/h4-5,7,15H,2-3,6H2,1H3 |
| InChIKey | CSKDAOADMBXQFX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|