C14H15F2N3O — CID 115408648
N-(2,2-difluoroethyl)-1-(ethylamino)isoquinoline-3-carboxamide (PubChem CID 115408648) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(ethylamino)isoquinoline-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-1-(ethylamino)isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 115408648 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(ethylamino)isoquinoline-3-carboxamide |
| SMILES | CCNc1nc(C(=O)NCC(F)F)cc2ccccc12 |
| InChI | InChI=1S/C14H15F2N3O/c1-2-17-13-10-6-4-3-5-9(10)7-11(19-13)14(20)18-8-12(15)16/h3-7,12H,2,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | WVCFGHCDMFGUGX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |