C16H19N3OS — CID 62166101
[1-(ethylamino)isoquinolin-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 62166101) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is [1-(ethylamino)isoquinolin-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(ethylamino)isoquinolin-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 62166101 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [1-(ethylamino)isoquinolin-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | CCNc1nc(C(=O)N2CCSCC2)cc2ccccc12 |
| InChI | InChI=1S/C16H19N3OS/c1-2-17-15-13-6-4-3-5-12(13)11-14(18-15)16(20)19-7-9-21-10-8-19/h3-6,11H,2,7-10H2,1H3,(H,17,18) |
| InChIKey | QNTLNTPJIBQTNF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |