C21H30N4O — CID 11394108
N,N,3-triethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide (PubChem CID 11394108) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is N,N,3-triethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide.
| Compound Name | N,N,3-triethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11394108 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N,N,3-triethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
| SMILES | CCc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)N(CC)CC |
| InChI | InChI=1S/C21H30N4O/c1-5-16-19(21(26)24(6-2)7-3)17-10-8-9-11-18(17)22-20(16)25-14-12-23(4)13-15-25/h8-11H,5-7,12-15H2,1-4H3 |
| InChIKey | LHITVBUSTSCLED-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |