C30H32N4O2 — CID 87710583
N-ethyl-3-[(4-methyl-1-oxidopiperazin-1-ium-1-yl)methyl]-N,2-diphenylquinoline-4-carboxamide (PubChem CID 87710583) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-ethyl-3-[(4-methyl-1-oxidopiperazin-1-ium-1-yl)methyl]-N,2-diphenylquinoline-4-carboxamide.
| Compound Name | N-ethyl-3-[(4-methyl-1-oxidopiperazin-1-ium-1-yl)methyl]-N,2-diphenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 87710583 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-ethyl-3-[(4-methyl-1-oxidopiperazin-1-ium-1-yl)methyl]-N,2-diphenylquinoline-4-carboxamide |
| SMILES | CCN(C(=O)c1c(C[N+]2([O-])CCN(C)CC2)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H32N4O2/c1-3-33(24-14-8-5-9-15-24)30(35)28-25-16-10-11-17-27(25)31-29(23-12-6-4-7-13-23)26(28)22-34(36)20-18-32(2)19-21-34/h4-17H,3,18-22H2,1-2H3 |
| InChIKey | GZSDPFGMPUNQKM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|