C21H22N4O4S — CID 23497681
2-phenyl-3-[(4-sulfamoylpiperazin-1-yl)methyl]quinoline-4-carboxylic acid (PubChem CID 23497681) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-phenyl-3-[(4-sulfamoylpiperazin-1-yl)methyl]quinoline-4-carboxylic acid.
| Compound Name | 2-phenyl-3-[(4-sulfamoylpiperazin-1-yl)methyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 23497681 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-phenyl-3-[(4-sulfamoylpiperazin-1-yl)methyl]quinoline-4-carboxylic acid |
| SMILES | NS(=O)(=O)N1CCN(Cc2c(-c3ccccc3)nc3ccccc3c2C(=O)O)CC1 |
| InChI | InChI=1S/C21H22N4O4S/c22-30(28,29)25-12-10-24(11-13-25)14-17-19(21(26)27)16-8-4-5-9-18(16)23-20(17)15-6-2-1-3-7-15/h1-9H,10-14H2,(H,26,27)(H2,22,28,29) |
| InChIKey | HEVDMSZMTNEFFR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |