C30H28F3N5O5S — CID 68967980
methyl N-phenyl-N-[[2-phenyl-3-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]quinoline-4-carbonyl]amino]carbamate (PubChem CID 68967980) has the molecular formula C30H28F3N5O5S and a molecular weight of 627.65 g/mol. Its IUPAC name is methyl N-phenyl-N-[[2-phenyl-3-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]quinoline-4-carbonyl]amino]carbamate.
| Compound Name | methyl N-phenyl-N-[[2-phenyl-3-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]quinoline-4-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 68967980 |
| Molecular Formula | C30H28F3N5O5S |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | methyl N-phenyl-N-[[2-phenyl-3-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]quinoline-4-carbonyl]amino]carbamate |
| SMILES | COC(=O)N(NC(=O)c1c(CN2CCN(S(=O)(=O)C(F)(F)F)CC2)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H28F3N5O5S/c1-43-29(40)38(22-12-6-3-7-13-22)35-28(39)26-23-14-8-9-15-25(23)34-27(21-10-4-2-5-11-21)24(26)20-36-16-18-37(19-17-36)44(41,42)30(31,32)33/h2-15H,16-20H2,1H3,(H,35,39) |
| InChIKey | LNVQEVBCKOOFLZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|