C32H27N5O3 — CID 68969814
methyl N-[[3-(2,3-dihydropyrrolo[2,3-b]pyridin-1-ylmethyl)-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate (PubChem CID 68969814) has the molecular formula C32H27N5O3 and a molecular weight of 529.60 g/mol. Its IUPAC name is methyl N-[[3-(2,3-dihydropyrrolo[2,3-b]pyridin-1-ylmethyl)-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate.
| Compound Name | methyl N-[[3-(2,3-dihydropyrrolo[2,3-b]pyridin-1-ylmethyl)-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate |
|---|---|
| PubChem CID | 68969814 |
| Molecular Formula | C32H27N5O3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | methyl N-[[3-(2,3-dihydropyrrolo[2,3-b]pyridin-1-ylmethyl)-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate |
| SMILES | COC(=O)N(NC(=O)c1c(CN2CCc3cccnc32)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C32H27N5O3/c1-40-32(39)37(24-14-6-3-7-15-24)35-31(38)28-25-16-8-9-17-27(25)34-29(22-11-4-2-5-12-22)26(28)21-36-20-18-23-13-10-19-33-30(23)36/h2-17,19H,18,20-21H2,1H3,(H,35,38) |
| InChIKey | PLTKANJGFUSOQQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|