C30H28N4O5 — CID 68968156
(2S)-1-[[4-[(N-methoxycarbonylanilino)carbamoyl]-2-phenylquinolin-3-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 68968156) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is (2S)-1-[[4-[(N-methoxycarbonylanilino)carbamoyl]-2-phenylquinolin-3-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[4-[(N-methoxycarbonylanilino)carbamoyl]-2-phenylquinolin-3-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68968156 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (2S)-1-[[4-[(N-methoxycarbonylanilino)carbamoyl]-2-phenylquinolin-3-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COC(=O)N(NC(=O)c1c(CN2CCC[C@H]2C(=O)O)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H28N4O5/c1-39-30(38)34(21-13-6-3-7-14-21)32-28(35)26-22-15-8-9-16-24(22)31-27(20-11-4-2-5-12-20)23(26)19-33-18-10-17-25(33)29(36)37/h2-9,11-16,25H,10,17-19H2,1H3,(H,32,35)(H,36,37)/t25-/m0/s1 |
| InChIKey | HMAJJOCWKWGHCT-VWLOTQADSA-N |
| XLogP | 4.87 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|