C32H33N5O4 — CID 68971391
methyl N-[[3-[[3-[acetyl(methyl)amino]pyrrolidin-1-yl]methyl]-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate (PubChem CID 68971391) has the molecular formula C32H33N5O4 and a molecular weight of 551.65 g/mol. Its IUPAC name is methyl N-[[3-[[3-[acetyl(methyl)amino]pyrrolidin-1-yl]methyl]-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate.
| Compound Name | methyl N-[[3-[[3-[acetyl(methyl)amino]pyrrolidin-1-yl]methyl]-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate |
|---|---|
| PubChem CID | 68971391 |
| Molecular Formula | C32H33N5O4 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | methyl N-[[3-[[3-[acetyl(methyl)amino]pyrrolidin-1-yl]methyl]-2-phenylquinoline-4-carbonyl]amino]-N-phenylcarbamate |
| SMILES | COC(=O)N(NC(=O)c1c(CN2CCC(N(C)C(C)=O)C2)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C32H33N5O4/c1-22(38)35(2)25-18-19-36(20-25)21-27-29(31(39)34-37(32(40)41-3)24-14-8-5-9-15-24)26-16-10-11-17-28(26)33-30(27)23-12-6-4-7-13-23/h4-17,25H,18-21H2,1-3H3,(H,34,39) |
| InChIKey | LDRHMHKDKZWKBV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|