C18H17N3O3S — CID 100748871
N-(2,5-dimethoxyphenyl)-4-(4-methylphenyl)thiadiazole-5-carboxamide (PubChem CID 100748871) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-(4-methylphenyl)thiadiazole-5-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-(4-methylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100748871 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-(4-methylphenyl)thiadiazole-5-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2snnc2-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H17N3O3S/c1-11-4-6-12(7-5-11)16-17(25-21-20-16)18(22)19-14-10-13(23-2)8-9-15(14)24-3/h4-10H,1-3H3,(H,19,22) |
| InChIKey | DHRDBECJYGIDKS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |