C16H11BrClN3O2S — CID 100750933
4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)thiadiazole-5-carboxamide (PubChem CID 100750933) has the molecular formula C16H11BrClN3O2S and a molecular weight of 424.71 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)thiadiazole-5-carboxamide.
| Compound Name | 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100750933 |
| Molecular Formula | C16H11BrClN3O2S |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 4-(4-bromophenyl)-N-(3-chloro-4-methoxyphenyl)thiadiazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2snnc2-c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C16H11BrClN3O2S/c1-23-13-7-6-11(8-12(13)18)19-16(22)15-14(20-21-24-15)9-2-4-10(17)5-3-9/h2-8H,1H3,(H,19,22) |
| InChIKey | HLCCCIDSUKGAPA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |