C11H10BrN3OS — CID 100750357
4-(4-bromophenyl)-N-ethylthiadiazole-5-carboxamide (PubChem CID 100750357) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-ethylthiadiazole-5-carboxamide.
| Compound Name | 4-(4-bromophenyl)-N-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100750357 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 4-(4-bromophenyl)-N-ethylthiadiazole-5-carboxamide |
| SMILES | CCNC(=O)c1snnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H10BrN3OS/c1-2-13-11(16)10-9(14-15-17-10)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3,(H,13,16) |
| InChIKey | HQNWVCJLUUEQHM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |