C17H14BrN3OS — CID 100750600
4-(4-bromophenyl)-N-(2,6-dimethylphenyl)thiadiazole-5-carboxamide (PubChem CID 100750600) has the molecular formula C17H14BrN3OS and a molecular weight of 388.29 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-(2,6-dimethylphenyl)thiadiazole-5-carboxamide.
| Compound Name | 4-(4-bromophenyl)-N-(2,6-dimethylphenyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100750600 |
| Molecular Formula | C17H14BrN3OS |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 4-(4-bromophenyl)-N-(2,6-dimethylphenyl)thiadiazole-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1snnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrN3OS/c1-10-4-3-5-11(2)14(10)19-17(22)16-15(20-21-23-16)12-6-8-13(18)9-7-12/h3-9H,1-2H3,(H,19,22) |
| InChIKey | IBVNTXJGGSSWPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |