C23H18ClN5O2S2 — CID 141023427
N-[4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]phenyl]-4-phenylthiadiazole-5-carboxamide (PubChem CID 141023427) has the molecular formula C23H18ClN5O2S2 and a molecular weight of 496.02 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]phenyl]-4-phenylthiadiazole-5-carboxamide.
| Compound Name | N-[4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]phenyl]-4-phenylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 141023427 |
| Molecular Formula | C23H18ClN5O2S2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-[4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]phenyl]-4-phenylthiadiazole-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=S)Nc1ccc(NC(=O)c2snnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClN5O2S2/c1-31-19-12-7-15(24)13-18(19)27-23(32)26-17-10-8-16(9-11-17)25-22(30)21-20(28-29-33-21)14-5-3-2-4-6-14/h2-13H,1H3,(H,25,30)(H2,26,27,32) |
| InChIKey | WYRUMXVLAPLGCF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|