C17H13BrClN3OS — CID 133200562
4-(4-bromophenyl)-N-[1-(4-chlorophenyl)ethyl]thiadiazole-5-carboxamide (PubChem CID 133200562) has the molecular formula C17H13BrClN3OS and a molecular weight of 422.74 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[1-(4-chlorophenyl)ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-(4-bromophenyl)-N-[1-(4-chlorophenyl)ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 133200562 |
| Molecular Formula | C17H13BrClN3OS |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 4-(4-bromophenyl)-N-[1-(4-chlorophenyl)ethyl]thiadiazole-5-carboxamide |
| SMILES | CC(NC(=O)c1snnc1-c1ccc(Br)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13BrClN3OS/c1-10(11-4-8-14(19)9-5-11)20-17(23)16-15(21-22-24-16)12-2-6-13(18)7-3-12/h2-10H,1H3,(H,20,23) |
| InChIKey | UBNIUSMJRPYKDM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |