C15H12ClN3OS2 — CID 100752637
N-[(1S)-1-(4-chlorophenyl)ethyl]-4-thiophen-2-ylthiadiazole-5-carboxamide (PubChem CID 100752637) has the molecular formula C15H12ClN3OS2 and a molecular weight of 349.87 g/mol. Its IUPAC name is N-[(1S)-1-(4-chlorophenyl)ethyl]-4-thiophen-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-4-thiophen-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100752637 |
| Molecular Formula | C15H12ClN3OS2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-[(1S)-1-(4-chlorophenyl)ethyl]-4-thiophen-2-ylthiadiazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1snnc1-c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3OS2/c1-9(10-4-6-11(16)7-5-10)17-15(20)14-13(18-19-22-14)12-3-2-8-21-12/h2-9H,1H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | ABUUBJRZRFXGCY-VIFPVBQESA-N |
| XLogP | 4.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |