C11H13N3OS2 — CID 100751536
N-[(2S)-butan-2-yl]-4-thiophen-2-ylthiadiazole-5-carboxamide (PubChem CID 100751536) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-4-thiophen-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-4-thiophen-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 100751536 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-[(2S)-butan-2-yl]-4-thiophen-2-ylthiadiazole-5-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1snnc1-c1cccs1 |
| InChI | InChI=1S/C11H13N3OS2/c1-3-7(2)12-11(15)10-9(13-14-17-10)8-5-4-6-16-8/h4-7H,3H2,1-2H3,(H,12,15)/t7-/m0/s1 |
| InChIKey | RMUOTFOOJLZCLE-ZETCQYMHSA-N |
| XLogP | 2.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |