C23H22N4O3S — CID 78839242
N-[3H-benzimidazol-5-yl(phenyl)methyl]-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 78839242) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[3H-benzimidazol-5-yl(phenyl)methyl]-3,4-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3,4-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 78839242 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[3H-benzimidazol-5-yl(phenyl)methyl]-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)NC(c2ccccc2)c2ccc3nc[nH]c3c2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C23H22N4O3S/c1-14-10-18(12-21(15(14)2)31(24,29)30)23(28)27-22(16-6-4-3-5-7-16)17-8-9-19-20(11-17)26-13-25-19/h3-13,22H,1-2H3,(H,25,26)(H,27,28)(H2,24,29,30) |
| InChIKey | REGIQBOPVKUXBF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |