C17H10F5N3O2S — CID 86912306
N'-(2,3,4,5,6-pentafluorophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzohydrazide (PubChem CID 86912306) has the molecular formula C17H10F5N3O2S and a molecular weight of 415.34 g/mol. Its IUPAC name is N'-(2,3,4,5,6-pentafluorophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzohydrazide.
| Compound Name | N'-(2,3,4,5,6-pentafluorophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 86912306 |
| Molecular Formula | C17H10F5N3O2S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N'-(2,3,4,5,6-pentafluorophenyl)-3-(1,3-thiazol-4-ylmethoxy)benzohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C17H10F5N3O2S/c18-11-12(19)14(21)16(15(22)13(11)20)24-25-17(26)8-2-1-3-10(4-8)27-5-9-6-28-7-23-9/h1-4,6-7,24H,5H2,(H,25,26) |
| InChIKey | HJIHQXIJNIRUMJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|