C23H24N2O4S — CID 86911740
[4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 86911740) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 86911740 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [4-[2,2-dimethylpropanoyl(methyl)amino]phenyl] 3-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | CN(C(=O)C(C)(C)C)c1ccc(OC(=O)c2cccc(OCc3cscn3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O4S/c1-23(2,3)22(27)25(4)18-8-10-19(11-9-18)29-21(26)16-6-5-7-20(12-16)28-13-17-14-30-15-24-17/h5-12,14-15H,13H2,1-4H3 |
| InChIKey | AWVYPIIZPRLRDX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|