C11H11NO2S — CID 28782947
[3-(1,3-thiazol-4-ylmethoxy)phenyl]methanol (PubChem CID 28782947) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is [3-(1,3-thiazol-4-ylmethoxy)phenyl]methanol.
| Compound Name | [3-(1,3-thiazol-4-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 28782947 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [3-(1,3-thiazol-4-ylmethoxy)phenyl]methanol |
| SMILES | OCc1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C11H11NO2S/c13-5-9-2-1-3-11(4-9)14-6-10-7-15-8-12-10/h1-4,7-8,13H,5-6H2 |
| InChIKey | ZZJLVKCNZUBDNS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |