C22H28N2O4 — CID 87531019
4-[2-(4-benzylpiperazin-1-yl)ethoxy]-3,5-dimethoxybenzaldehyde (PubChem CID 87531019) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[2-(4-benzylpiperazin-1-yl)ethoxy]-3,5-dimethoxybenzaldehyde.
| Compound Name | 4-[2-(4-benzylpiperazin-1-yl)ethoxy]-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 87531019 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[2-(4-benzylpiperazin-1-yl)ethoxy]-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1OCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O4/c1-26-20-14-19(17-25)15-21(27-2)22(20)28-13-12-23-8-10-24(11-9-23)16-18-6-4-3-5-7-18/h3-7,14-15,17H,8-13,16H2,1-2H3 |
| InChIKey | QKMOJEICCKMCDG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|