C19H18F3NO5 — CID 171856794
benzyl N-[3-[4-formyl-2-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171856794) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is benzyl N-[3-[4-formyl-2-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[4-formyl-2-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856794 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | benzyl N-[3-[4-formyl-2-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3NO5/c20-19(21,22)15-8-13(10-24)6-7-14(15)17(26)16(25)9-23-18(27)28-11-12-4-2-1-3-5-12/h1-8,10,16-17,25-26H,9,11H2,(H,23,27) |
| InChIKey | SESKGUHWXYAIHE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|