C18H16ClF3N4O2 — CID 3117787
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[[4-(dimethylamino)phenyl]methylideneamino]oxamide (PubChem CID 3117787) has the molecular formula C18H16ClF3N4O2 and a molecular weight of 412.80 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[[4-(dimethylamino)phenyl]methylideneamino]oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[[4-(dimethylamino)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3117787 |
| Molecular Formula | C18H16ClF3N4O2 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[[4-(dimethylamino)phenyl]methylideneamino]oxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16ClF3N4O2/c1-26(2)13-6-3-11(4-7-13)10-23-25-17(28)16(27)24-12-5-8-15(19)14(9-12)18(20,21)22/h3-10H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | DYMJIRFATARBNL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|