C12H16N4O2 — CID 4106726
N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-methyloxamide (PubChem CID 4106726) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-methyloxamide.
| Compound Name | N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-methyloxamide |
|---|---|
| PubChem CID | 4106726 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NN=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H16N4O2/c1-13-11(17)12(18)15-14-8-9-4-6-10(7-5-9)16(2)3/h4-8H,1-3H3,(H,13,17)(H,15,18) |
| InChIKey | FLZJNCZZQSPVIZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|