C17H17FN4O2 — CID 4218592
N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-(3-fluorophenyl)oxamide (PubChem CID 4218592) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-(3-fluorophenyl)oxamide.
| Compound Name | N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 4218592 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N'-[[4-(dimethylamino)phenyl]methylideneamino]-N-(3-fluorophenyl)oxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H17FN4O2/c1-22(2)15-8-6-12(7-9-15)11-19-21-17(24)16(23)20-14-5-3-4-13(18)10-14/h3-11H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YEMYRXJPCNIAOD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|