C12H24N6S2 — CID 2725287
1-tert-butyl-3-[2-(tert-butylcarbamothioylhydrazinylidene)ethylideneamino]thiourea (PubChem CID 2725287) has the molecular formula C12H24N6S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(tert-butylcarbamothioylhydrazinylidene)ethylideneamino]thiourea.
| Compound Name | 1-tert-butyl-3-[2-(tert-butylcarbamothioylhydrazinylidene)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 2725287 |
| Molecular Formula | C12H24N6S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-tert-butyl-3-[2-(tert-butylcarbamothioylhydrazinylidene)ethylideneamino]thiourea |
| SMILES | CC(C)(C)NC(=S)NN=CC=NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C12H24N6S2/c1-11(2,3)15-9(19)17-13-7-8-14-18-10(20)16-12(4,5)6/h7-8H,1-6H3,(H2,15,17,19)(H2,16,18,20) |
| InChIKey | CUKVJPQNPOQDQY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|