C12H17N3OS — CID 2725308
1-tert-butyl-3-[(4-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 2725308) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is 1-tert-butyl-3-[(4-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-tert-butyl-3-[(4-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2725308 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-tert-butyl-3-[(4-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | CC(C)(C)NC(=S)NN=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H17N3OS/c1-12(2,3)14-11(17)15-13-8-9-4-6-10(16)7-5-9/h4-8,16H,1-3H3,(H2,14,15,17) |
| InChIKey | UBOCZTAQJPHFDS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|