C8H8N2OS2 — CID 716613
[(4-hydroxyphenyl)methylideneamino]carbamodithioic acid (PubChem CID 716613) has the molecular formula C8H8N2OS2 and a molecular weight of 212.30 g/mol. Its IUPAC name is [(4-hydroxyphenyl)methylideneamino]carbamodithioic acid.
| Compound Name | [(4-hydroxyphenyl)methylideneamino]carbamodithioic acid |
|---|---|
| PubChem CID | 716613 |
| Molecular Formula | C8H8N2OS2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | [(4-hydroxyphenyl)methylideneamino]carbamodithioic acid |
| SMILES | Oc1ccc(C=NNC(=S)S)cc1 |
| InChI | InChI=1S/C8H8N2OS2/c11-7-3-1-6(2-4-7)5-9-10-8(12)13/h1-5,11H,(H2,10,12,13) |
| InChIKey | PGAHOWAKWYJPDV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|