C16H15F2N3S — CID 6902118
1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 6902118) has the molecular formula C16H15F2N3S and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 6902118 |
| Molecular Formula | C16H15F2N3S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N/N=C/c2ccc(F)c(F)c2)cc1C |
| InChI | InChI=1S/C16H15F2N3S/c1-10-3-5-13(7-11(10)2)20-16(22)21-19-9-12-4-6-14(17)15(18)8-12/h3-9H,1-2H3,(H2,20,21,22)/b19-9+ |
| InChIKey | SEIMWHYAYJRMDL-DJKKODMXSA-N |
| XLogP | 3.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|