C36H48N2 — CID 132601472
N-(3,5-ditert-butylphenyl)-1-[4-[(3,5-ditert-butylphenyl)iminomethyl]phenyl]methanimine (PubChem CID 132601472) has the molecular formula C36H48N2 and a molecular weight of 508.79 g/mol. Its IUPAC name is N-(3,5-ditert-butylphenyl)-1-[4-[(3,5-ditert-butylphenyl)iminomethyl]phenyl]methanimine.
| Compound Name | N-(3,5-ditert-butylphenyl)-1-[4-[(3,5-ditert-butylphenyl)iminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 132601472 |
| Molecular Formula | C36H48N2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | N-(3,5-ditert-butylphenyl)-1-[4-[(3,5-ditert-butylphenyl)iminomethyl]phenyl]methanimine |
| SMILES | CC(C)(C)c1cc(/N=C/c2ccc(/C=N/c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H48N2/c1-33(2,3)27-17-28(34(4,5)6)20-31(19-27)37-23-25-13-15-26(16-14-25)24-38-32-21-29(35(7,8)9)18-30(22-32)36(10,11)12/h13-24H,1-12H3/b37-23+,38-24+ |
| InChIKey | KCKSQMLTRKFKBH-DNJOOXRZSA-N |
| XLogP | 10.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|