C25H20F9NO2 — CID 172950776
1-ethyl-4-(trifluoromethyl)benzene;4-(trifluoromethyl)benzaldehyde;(NE)-N-[[4-(trifluoromethyl)phenyl]methylidene]hydroxylamine (PubChem CID 172950776) has the molecular formula C25H20F9NO2 and a molecular weight of 537.42 g/mol. Its IUPAC name is 1-ethyl-4-(trifluoromethyl)benzene;4-(trifluoromethyl)benzaldehyde;(NE)-N-[[4-(trifluoromethyl)phenyl]methylidene]hydroxylamine.
| Compound Name | 1-ethyl-4-(trifluoromethyl)benzene;4-(trifluoromethyl)benzaldehyde;(NE)-N-[[4-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172950776 |
| Molecular Formula | C25H20F9NO2 |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 1-ethyl-4-(trifluoromethyl)benzene;4-(trifluoromethyl)benzaldehyde;(NE)-N-[[4-(trifluoromethyl)phenyl]methylidene]hydroxylamine |
| SMILES | CCc1ccc(C(F)(F)F)cc1.O/N=C/c1ccc(C(F)(F)F)cc1.O=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3.C8H6F3NO.C8H5F3O/c1-2-7-3-5-8(6-4-7)9(10,11)12;9-8(10,11)7-3-1-6(2-4-7)5-12-13;9-8(10,11)7-3-1-6(5-12)2-4-7/h3-6H,2H2,1H3;1-5,13H;1-5H/b;12-5+; |
| InChIKey | JILJMSCEUSYMCI-JBIHJFDSSA-N |
| XLogP | 8.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|