C17H15F4NO5S2 — CID 59635821
2-[[(E)-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenyl]sulfonylmethyl]benzenesulfonamide (PubChem CID 59635821) has the molecular formula C17H15F4NO5S2 and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-[[(E)-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenyl]sulfonylmethyl]benzenesulfonamide.
| Compound Name | 2-[[(E)-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenyl]sulfonylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59635821 |
| Molecular Formula | C17H15F4NO5S2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 2-[[(E)-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethenyl]sulfonylmethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1CS(=O)(=O)/C=C/c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C17H15F4NO5S2/c18-16(19)17(20,21)27-14-7-5-12(6-8-14)9-10-28(23,24)11-13-3-1-2-4-15(13)29(22,25)26/h1-10,16H,11H2,(H2,22,25,26)/b10-9+ |
| InChIKey | VOQZEUIUQCGGEF-MDZDMXLPSA-N |
| XLogP | 3.16 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|