C13H14O3 — CID 102389358
methyl (2E)-2-(3-methoxyphenyl)penta-2,4-dienoate (PubChem CID 102389358) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is methyl (2E)-2-(3-methoxyphenyl)penta-2,4-dienoate.
| Compound Name | methyl (2E)-2-(3-methoxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 102389358 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | methyl (2E)-2-(3-methoxyphenyl)penta-2,4-dienoate |
| SMILES | C=C/C=C(/C(=O)OC)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H14O3/c1-4-6-12(13(14)16-3)10-7-5-8-11(9-10)15-2/h4-9H,1H2,2-3H3/b12-6+ |
| InChIKey | XMEPOTWYVCMQKB-WUXMJOGZSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|