C20H22O3 — CID 18520311
1-phenyl-2-(2,3,4-triethyl-5-hydroxyphenyl)ethane-1,2-dione (PubChem CID 18520311) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-phenyl-2-(2,3,4-triethyl-5-hydroxyphenyl)ethane-1,2-dione.
| Compound Name | 1-phenyl-2-(2,3,4-triethyl-5-hydroxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 18520311 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-phenyl-2-(2,3,4-triethyl-5-hydroxyphenyl)ethane-1,2-dione |
| SMILES | CCc1c(O)cc(C(=O)C(=O)c2ccccc2)c(CC)c1CC |
| InChI | InChI=1S/C20H22O3/c1-4-14-15(5-2)17(12-18(21)16(14)6-3)20(23)19(22)13-10-8-7-9-11-13/h7-12,21H,4-6H2,1-3H3 |
| InChIKey | CUEUGQGTOSFPOX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|