C20H26BrNO2 — CID 174431283
azane;1-phenyl-2-(2,3,4-triethylphenyl)ethane-1,2-dione;hydrobromide (PubChem CID 174431283) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is azane;1-phenyl-2-(2,3,4-triethylphenyl)ethane-1,2-dione;hydrobromide.
| Compound Name | azane;1-phenyl-2-(2,3,4-triethylphenyl)ethane-1,2-dione;hydrobromide |
|---|---|
| PubChem CID | 174431283 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | azane;1-phenyl-2-(2,3,4-triethylphenyl)ethane-1,2-dione;hydrobromide |
| SMILES | Br.CCc1ccc(C(=O)C(=O)c2ccccc2)c(CC)c1CC.N |
| InChI | InChI=1S/C20H22O2.BrH.H3N/c1-4-14-12-13-18(17(6-3)16(14)5-2)20(22)19(21)15-10-8-7-9-11-15;;/h7-13H,4-6H2,1-3H3;1H;1H3 |
| InChIKey | XGDCGCLTEUORSS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|