C33H31O2P — CID 90234060
dinaphthalen-1-ylphosphoryl-(2,3,4-triethylphenyl)methanone (PubChem CID 90234060) has the molecular formula C33H31O2P and a molecular weight of 490.58 g/mol. Its IUPAC name is dinaphthalen-1-ylphosphoryl-(2,3,4-triethylphenyl)methanone.
| Compound Name | dinaphthalen-1-ylphosphoryl-(2,3,4-triethylphenyl)methanone |
|---|---|
| PubChem CID | 90234060 |
| Molecular Formula | C33H31O2P |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | dinaphthalen-1-ylphosphoryl-(2,3,4-triethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)P(=O)(c2cccc3ccccc23)c2cccc3ccccc23)c(CC)c1CC |
| InChI | InChI=1S/C33H31O2P/c1-4-23-21-22-30(27(6-3)26(23)5-2)33(34)36(35,31-19-11-15-24-13-7-9-17-28(24)31)32-20-12-16-25-14-8-10-18-29(25)32/h7-22H,4-6H2,1-3H3 |
| InChIKey | QZZKGVIWEPWHIY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|