C16H21N — CID 88846211
aziridine;1,2-diethylnaphthalene (PubChem CID 88846211) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is aziridine;1,2-diethylnaphthalene.
| Compound Name | aziridine;1,2-diethylnaphthalene |
|---|---|
| PubChem CID | 88846211 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | aziridine;1,2-diethylnaphthalene |
| SMILES | C1CN1.CCc1ccc2ccccc2c1CC |
| InChI | InChI=1S/C14H16.C2H5N/c1-3-11-9-10-12-7-5-6-8-14(12)13(11)4-2;1-2-3-1/h5-10H,3-4H2,1-2H3;3H,1-2H2 |
| InChIKey | PPDIKOVZKHZZBR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|