About CID 173411630
CID 173411630 (PubChem CID 173411630) has the molecular formula C12H11Al
and a molecular weight of 182.20 g/mol.
Molecular Properties
| Compound Name | CID 173411630 |
| PubChem CID | 173411630 |
| Molecular Formula | C12H11Al |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | — |
| SMILES | CCc1ccc2ccccc2c1[Al] |
| InChI | InChI=1S/C12H11.Al/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;/h3-8H,2H2,1H3; |
| InChIKey | ZXDJVDXEGJNOKJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173411630 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173411630?
The IUPAC name of CID 173411630 (CID 173411630) is not available.
What is the SMILES notation for CID 173411630?
The canonical SMILES for CID 173411630 is CCc1ccc2ccccc2c1[Al].
What is the InChIKey of CID 173411630?
The InChIKey is ZXDJVDXEGJNOKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11.Al/c1-2-10-7-8-11-5-3-4-6-12(11)9-10;/h3-8H,2H2,1H3;.
What are the key properties of CID 173411630?
CID 173411630 has a molecular weight of 182.20 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173411630 is sourced from PubChem (CID 173411630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).