C23H38O — CID 175319778
2,3-dioctylbenzaldehyde (PubChem CID 175319778) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,3-dioctylbenzaldehyde.
| Compound Name | 2,3-dioctylbenzaldehyde |
|---|---|
| PubChem CID | 175319778 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 2,3-dioctylbenzaldehyde |
| SMILES | CCCCCCCCc1cccc(C=O)c1CCCCCCCC |
| InChI | InChI=1S/C23H38O/c1-3-5-7-9-11-13-16-21-17-15-18-22(20-24)23(21)19-14-12-10-8-6-4-2/h15,17-18,20H,3-14,16,19H2,1-2H3 |
| InChIKey | LGHCQPZHYHMUFK-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|