C12H14Br2 — CID 141180413
1-butyl-2-(2,2-dibromoethenyl)benzene (PubChem CID 141180413) has the molecular formula C12H14Br2 and a molecular weight of 318.05 g/mol. Its IUPAC name is 1-butyl-2-(2,2-dibromoethenyl)benzene.
| Compound Name | 1-butyl-2-(2,2-dibromoethenyl)benzene |
|---|---|
| PubChem CID | 141180413 |
| Molecular Formula | C12H14Br2 |
| Molecular Weight | 318.05 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 1-butyl-2-(2,2-dibromoethenyl)benzene |
| SMILES | CCCCc1ccccc1C=C(Br)Br |
| InChI | InChI=1S/C12H14Br2/c1-2-3-6-10-7-4-5-8-11(10)9-12(13)14/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | KITDMAYTUSRZAI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.05 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |