About 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen
1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen (PubChem CID 165392060) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen |
| PubChem CID | 165392060 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen |
| SMILES | C=CC(C)CC.CCc1cccc(C)c1C.[H][H] |
| InChI | InChI=1S/C10H14.C6H12.H2/c1-4-10-7-5-6-8(2)9(10)3;1-4-6(3)5-2;/h5-7H,4H2,1-3H3;4,6H,1,5H2,2-3H3;1H |
| InChIKey | XLYJOXCSXSKHSX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen?
The IUPAC name of 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen (CID 165392060) is 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen.
What is the SMILES notation for 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen?
The canonical SMILES for 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen is C=CC(C)CC.CCc1cccc(C)c1C.[H][H].
What is the InChIKey of 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen?
The InChIKey is XLYJOXCSXSKHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C6H12.H2/c1-4-10-7-5-6-8(2)9(10)3;1-4-6(3)5-2;/h5-7H,4H2,1-3H3;4,6H,1,5H2,2-3H3;1H.
What are the key properties of 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen?
1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen has a molecular weight of 220.40 g/mol, XLogP of 5.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethylbenzene;3-methylpent-1-ene;molecular hydrogen is sourced from PubChem (CID 165392060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).