C13H20O — CID 122553324
1,2-dimethyl-3-(2-methylpropoxymethyl)benzene (PubChem CID 122553324) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylpropoxymethyl)benzene.
| Compound Name | 1,2-dimethyl-3-(2-methylpropoxymethyl)benzene |
|---|---|
| PubChem CID | 122553324 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylpropoxymethyl)benzene |
| SMILES | Cc1cccc(COCC(C)C)c1C |
| InChI | InChI=1S/C13H20O/c1-10(2)8-14-9-13-7-5-6-11(3)12(13)4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | WCSSSDFOMYACLY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |