C14H20O — CID 126674892
1-(cyclopentyloxymethyl)-2,3-dimethylbenzene (PubChem CID 126674892) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-(cyclopentyloxymethyl)-2,3-dimethylbenzene.
| Compound Name | 1-(cyclopentyloxymethyl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 126674892 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-(cyclopentyloxymethyl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(COC2CCCC2)c1C |
| InChI | InChI=1S/C14H20O/c1-11-6-5-7-13(12(11)2)10-15-14-8-3-4-9-14/h5-7,14H,3-4,8-10H2,1-2H3 |
| InChIKey | NKHLBIBTTRVNSA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |