C24H35NO2 — CID 54246822
ethyl 5-[4-(undec-10-enylamino)phenyl]penta-2,4-dienoate (PubChem CID 54246822) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is ethyl 5-[4-(undec-10-enylamino)phenyl]penta-2,4-dienoate.
| Compound Name | ethyl 5-[4-(undec-10-enylamino)phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 54246822 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | ethyl 5-[4-(undec-10-enylamino)phenyl]penta-2,4-dienoate |
| SMILES | C=CCCCCCCCCCNc1ccc(C=CC=CC(=O)OCC)cc1 |
| InChI | InChI=1S/C24H35NO2/c1-3-5-6-7-8-9-10-11-14-21-25-23-19-17-22(18-20-23)15-12-13-16-24(26)27-4-2/h3,12-13,15-20,25H,1,4-11,14,21H2,2H3 |
| InChIKey | QTVOJXYMHUREKD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|